C15H14FN3O5S — CID 55560089
N-[4-fluoro-3-[(2-methyl-5-nitrophenyl)sulfonylamino]phenyl]acetamide (PubChem CID 55560089) has the molecular formula C15H14FN3O5S and a molecular weight of 367.36 g/mol. Its IUPAC name is N-[4-fluoro-3-[(2-methyl-5-nitrophenyl)sulfonylamino]phenyl]acetamide.
| Compound Name | N-[4-fluoro-3-[(2-methyl-5-nitrophenyl)sulfonylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 55560089 |
| Molecular Formula | C15H14FN3O5S |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | N-[4-fluoro-3-[(2-methyl-5-nitrophenyl)sulfonylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(F)c(NS(=O)(=O)c2cc([N+](=O)[O-])ccc2C)c1 |
| InChI | InChI=1S/C15H14FN3O5S/c1-9-3-5-12(19(21)22)8-15(9)25(23,24)18-14-7-11(17-10(2)20)4-6-13(14)16/h3-8,18H,1-2H3,(H,17,20) |
| InChIKey | JVRGUALGSJILSN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|