C16H17FN2O3S — CID 24656726
N-[5-[(2,5-dimethylphenyl)sulfonylamino]-2-fluorophenyl]acetamide (PubChem CID 24656726) has the molecular formula C16H17FN2O3S and a molecular weight of 336.39 g/mol. Its IUPAC name is N-[5-[(2,5-dimethylphenyl)sulfonylamino]-2-fluorophenyl]acetamide.
| Compound Name | N-[5-[(2,5-dimethylphenyl)sulfonylamino]-2-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 24656726 |
| Molecular Formula | C16H17FN2O3S |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | N-[5-[(2,5-dimethylphenyl)sulfonylamino]-2-fluorophenyl]acetamide |
| SMILES | CC(=O)Nc1cc(NS(=O)(=O)c2cc(C)ccc2C)ccc1F |
| InChI | InChI=1S/C16H17FN2O3S/c1-10-4-5-11(2)16(8-10)23(21,22)19-13-6-7-14(17)15(9-13)18-12(3)20/h4-9,19H,1-3H3,(H,18,20) |
| InChIKey | IWBJFWYODKGVSX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |