C14H13ClFNO2S — CID 793232
N-(3-chloro-4-fluorophenyl)-2,5-dimethylbenzenesulfonamide (PubChem CID 793232) has the molecular formula C14H13ClFNO2S and a molecular weight of 313.78 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 793232 |
| Molecular Formula | C14H13ClFNO2S |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Nc2ccc(F)c(Cl)c2)c1 |
| InChI | InChI=1S/C14H13ClFNO2S/c1-9-3-4-10(2)14(7-9)20(18,19)17-11-5-6-13(16)12(15)8-11/h3-8,17H,1-2H3 |
| InChIKey | DDHVDDFDVVNPSY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |