C20H18Cl2N2O4S2 — CID 22202667
N-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]-2,5-dimethylbenzenesulfonamide (PubChem CID 22202667) has the molecular formula C20H18Cl2N2O4S2 and a molecular weight of 485.41 g/mol. Its IUPAC name is N-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 22202667 |
| Molecular Formula | C20H18Cl2N2O4S2 |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 484.01 |
| IUPAC Name | N-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Nc2ccc(S(=O)(=O)Nc3ccc(Cl)c(Cl)c3)cc2)c1 |
| InChI | InChI=1S/C20H18Cl2N2O4S2/c1-13-3-4-14(2)20(11-13)30(27,28)23-15-5-8-17(9-6-15)29(25,26)24-16-7-10-18(21)19(22)12-16/h3-12,23-24H,1-2H3 |
| InChIKey | CLXFRYRYISKDLQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |