C19H16ClFN2O4S2 — CID 24629200
2-chloro-N-[4-[(4-fluorophenyl)sulfonylamino]phenyl]-4-methylbenzenesulfonamide (PubChem CID 24629200) has the molecular formula C19H16ClFN2O4S2 and a molecular weight of 454.93 g/mol. Its IUPAC name is 2-chloro-N-[4-[(4-fluorophenyl)sulfonylamino]phenyl]-4-methylbenzenesulfonamide.
| Compound Name | 2-chloro-N-[4-[(4-fluorophenyl)sulfonylamino]phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 24629200 |
| Molecular Formula | C19H16ClFN2O4S2 |
| Molecular Weight | 454.93 g/mol |
| Exact Mass | 454.02 |
| IUPAC Name | 2-chloro-N-[4-[(4-fluorophenyl)sulfonylamino]phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(NS(=O)(=O)c3ccc(F)cc3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C19H16ClFN2O4S2/c1-13-2-11-19(18(20)12-13)29(26,27)23-16-7-5-15(6-8-16)22-28(24,25)17-9-3-14(21)4-10-17/h2-12,22-23H,1H3 |
| InChIKey | ITLMZEVCJBGYOV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.93 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_D(2)', 'substructure': 'N/A'} |
|---|