C19H23ClN2O4S2 — CID 24629185
2-chloro-4-methyl-N-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]benzenesulfonamide (PubChem CID 24629185) has the molecular formula C19H23ClN2O4S2 and a molecular weight of 442.99 g/mol. Its IUPAC name is 2-chloro-4-methyl-N-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]benzenesulfonamide.
| Compound Name | 2-chloro-4-methyl-N-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24629185 |
| Molecular Formula | C19H23ClN2O4S2 |
| Molecular Weight | 442.99 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 2-chloro-4-methyl-N-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(S(=O)(=O)N3CCCC(C)C3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C19H23ClN2O4S2/c1-14-5-10-19(18(20)12-14)27(23,24)21-16-6-8-17(9-7-16)28(25,26)22-11-3-4-15(2)13-22/h5-10,12,15,21H,3-4,11,13H2,1-2H3 |
| InChIKey | YFJXSQNISGKOCV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.99 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |