C18H21FN2O4S2 — CID 7343180
4-fluoro-N-[4-[(3S)-3-methylpiperidin-1-yl]sulfonylphenyl]benzenesulfonamide (PubChem CID 7343180) has the molecular formula C18H21FN2O4S2 and a molecular weight of 412.51 g/mol. Its IUPAC name is 4-fluoro-N-[4-[(3S)-3-methylpiperidin-1-yl]sulfonylphenyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[4-[(3S)-3-methylpiperidin-1-yl]sulfonylphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 7343180 |
| Molecular Formula | C18H21FN2O4S2 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 4-fluoro-N-[4-[(3S)-3-methylpiperidin-1-yl]sulfonylphenyl]benzenesulfonamide |
| SMILES | C[C@H]1CCCN(S(=O)(=O)c2ccc(NS(=O)(=O)c3ccc(F)cc3)cc2)C1 |
| InChI | InChI=1S/C18H21FN2O4S2/c1-14-3-2-12-21(13-14)27(24,25)18-10-6-16(7-11-18)20-26(22,23)17-8-4-15(19)5-9-17/h4-11,14,20H,2-3,12-13H2,1H3/t14-/m0/s1 |
| InChIKey | SQOXHROIDXXLHS-AWEZNQCLSA-N |
| XLogP | 3.05 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |