C18H26N4O4S2 — CID 27526282
1-ethyl-3-methyl-N-[4-[(3R)-3-methylpiperidin-1-yl]sulfonylphenyl]pyrazole-4-sulfonamide (PubChem CID 27526282) has the molecular formula C18H26N4O4S2 and a molecular weight of 426.56 g/mol. Its IUPAC name is 1-ethyl-3-methyl-N-[4-[(3R)-3-methylpiperidin-1-yl]sulfonylphenyl]pyrazole-4-sulfonamide.
| Compound Name | 1-ethyl-3-methyl-N-[4-[(3R)-3-methylpiperidin-1-yl]sulfonylphenyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 27526282 |
| Molecular Formula | C18H26N4O4S2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 1-ethyl-3-methyl-N-[4-[(3R)-3-methylpiperidin-1-yl]sulfonylphenyl]pyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)Nc2ccc(S(=O)(=O)N3CCC[C@@H](C)C3)cc2)c(C)n1 |
| InChI | InChI=1S/C18H26N4O4S2/c1-4-21-13-18(15(3)19-21)27(23,24)20-16-7-9-17(10-8-16)28(25,26)22-11-5-6-14(2)12-22/h7-10,13-14,20H,4-6,11-12H2,1-3H3/t14-/m1/s1 |
| InChIKey | QSTCNWLNDKTWEO-CQSZACIVSA-N |
| XLogP | 2.43 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |