C17H20N6O4S2 — CID 19683690
1-ethyl-3-methyl-N-[4-[(2-methylpyrimidin-4-yl)sulfamoyl]phenyl]pyrazole-4-sulfonamide (PubChem CID 19683690) has the molecular formula C17H20N6O4S2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 1-ethyl-3-methyl-N-[4-[(2-methylpyrimidin-4-yl)sulfamoyl]phenyl]pyrazole-4-sulfonamide.
| Compound Name | 1-ethyl-3-methyl-N-[4-[(2-methylpyrimidin-4-yl)sulfamoyl]phenyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 19683690 |
| Molecular Formula | C17H20N6O4S2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 1-ethyl-3-methyl-N-[4-[(2-methylpyrimidin-4-yl)sulfamoyl]phenyl]pyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)Nc2ccc(S(=O)(=O)Nc3ccnc(C)n3)cc2)c(C)n1 |
| InChI | InChI=1S/C17H20N6O4S2/c1-4-23-11-16(12(2)20-23)29(26,27)21-14-5-7-15(8-6-14)28(24,25)22-17-9-10-18-13(3)19-17/h5-11,21H,4H2,1-3H3,(H,18,19,22) |
| InChIKey | JIGUBLMJASZIRS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 135.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |