C19H20N4O4S2 — CID 19683655
4-ethyl-N-[4-[(2-methylpyrimidin-4-yl)sulfamoyl]phenyl]benzenesulfonamide (PubChem CID 19683655) has the molecular formula C19H20N4O4S2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 4-ethyl-N-[4-[(2-methylpyrimidin-4-yl)sulfamoyl]phenyl]benzenesulfonamide.
| Compound Name | 4-ethyl-N-[4-[(2-methylpyrimidin-4-yl)sulfamoyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 19683655 |
| Molecular Formula | C19H20N4O4S2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 4-ethyl-N-[4-[(2-methylpyrimidin-4-yl)sulfamoyl]phenyl]benzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2ccc(S(=O)(=O)Nc3ccnc(C)n3)cc2)cc1 |
| InChI | InChI=1S/C19H20N4O4S2/c1-3-15-4-8-17(9-5-15)28(24,25)22-16-6-10-18(11-7-16)29(26,27)23-19-12-13-20-14(2)21-19/h4-13,22H,3H2,1-2H3,(H,20,21,23) |
| InChIKey | VHNJOGHNLVFYGY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |