C16H19N5O2S — CID 22205282
1-ethyl-3-methyl-N-[4-(pyrazol-1-ylmethyl)phenyl]pyrazole-4-sulfonamide (PubChem CID 22205282) has the molecular formula C16H19N5O2S and a molecular weight of 345.43 g/mol. Its IUPAC name is 1-ethyl-3-methyl-N-[4-(pyrazol-1-ylmethyl)phenyl]pyrazole-4-sulfonamide.
| Compound Name | 1-ethyl-3-methyl-N-[4-(pyrazol-1-ylmethyl)phenyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 22205282 |
| Molecular Formula | C16H19N5O2S |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 1-ethyl-3-methyl-N-[4-(pyrazol-1-ylmethyl)phenyl]pyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)Nc2ccc(Cn3cccn3)cc2)c(C)n1 |
| InChI | InChI=1S/C16H19N5O2S/c1-3-20-12-16(13(2)18-20)24(22,23)19-15-7-5-14(6-8-15)11-21-10-4-9-17-21/h4-10,12,19H,3,11H2,1-2H3 |
| InChIKey | VXFXTLYBDWKKNC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |