C17H17N3O4S2 — CID 55902750
2-methylsulfonyl-N-[4-(pyrazol-1-ylmethyl)phenyl]benzenesulfonamide (PubChem CID 55902750) has the molecular formula C17H17N3O4S2 and a molecular weight of 391.47 g/mol. Its IUPAC name is 2-methylsulfonyl-N-[4-(pyrazol-1-ylmethyl)phenyl]benzenesulfonamide.
| Compound Name | 2-methylsulfonyl-N-[4-(pyrazol-1-ylmethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55902750 |
| Molecular Formula | C17H17N3O4S2 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 2-methylsulfonyl-N-[4-(pyrazol-1-ylmethyl)phenyl]benzenesulfonamide |
| SMILES | CS(=O)(=O)c1ccccc1S(=O)(=O)Nc1ccc(Cn2cccn2)cc1 |
| InChI | InChI=1S/C17H17N3O4S2/c1-25(21,22)16-5-2-3-6-17(16)26(23,24)19-15-9-7-14(8-10-15)13-20-12-4-11-18-20/h2-12,19H,13H2,1H3 |
| InChIKey | QGIOPVIHBGKCQW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |