C18H17N3O3S — CID 55534682
N-(2-methylsulfonylphenyl)-4-(pyrazol-1-ylmethyl)benzamide (PubChem CID 55534682) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is N-(2-methylsulfonylphenyl)-4-(pyrazol-1-ylmethyl)benzamide.
| Compound Name | N-(2-methylsulfonylphenyl)-4-(pyrazol-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55534682 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | N-(2-methylsulfonylphenyl)-4-(pyrazol-1-ylmethyl)benzamide |
| SMILES | CS(=O)(=O)c1ccccc1NC(=O)c1ccc(Cn2cccn2)cc1 |
| InChI | InChI=1S/C18H17N3O3S/c1-25(23,24)17-6-3-2-5-16(17)20-18(22)15-9-7-14(8-10-15)13-21-12-4-11-19-21/h2-12H,13H2,1H3,(H,20,22) |
| InChIKey | BNRQXRLUOYVNJG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |