C19H19N3O3 — CID 18141970
N-(2,4-dimethoxyphenyl)-4-(pyrazol-1-ylmethyl)benzamide (PubChem CID 18141970) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-4-(pyrazol-1-ylmethyl)benzamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-4-(pyrazol-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 18141970 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-4-(pyrazol-1-ylmethyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(Cn3cccn3)cc2)c(OC)c1 |
| InChI | InChI=1S/C19H19N3O3/c1-24-16-8-9-17(18(12-16)25-2)21-19(23)15-6-4-14(5-7-15)13-22-11-3-10-20-22/h3-12H,13H2,1-2H3,(H,21,23) |
| InChIKey | NOUKVEDKNUZKIP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |