C26H26N4O4S — CID 26045640
N-[3-[(4-ethoxyphenyl)sulfamoyl]-4-methylphenyl]-4-(pyrazol-1-ylmethyl)benzamide (PubChem CID 26045640) has the molecular formula C26H26N4O4S and a molecular weight of 490.59 g/mol. Its IUPAC name is N-[3-[(4-ethoxyphenyl)sulfamoyl]-4-methylphenyl]-4-(pyrazol-1-ylmethyl)benzamide.
| Compound Name | N-[3-[(4-ethoxyphenyl)sulfamoyl]-4-methylphenyl]-4-(pyrazol-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 26045640 |
| Molecular Formula | C26H26N4O4S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | N-[3-[(4-ethoxyphenyl)sulfamoyl]-4-methylphenyl]-4-(pyrazol-1-ylmethyl)benzamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2cc(NC(=O)c3ccc(Cn4cccn4)cc3)ccc2C)cc1 |
| InChI | InChI=1S/C26H26N4O4S/c1-3-34-24-13-11-22(12-14-24)29-35(32,33)25-17-23(10-5-19(25)2)28-26(31)21-8-6-20(7-9-21)18-30-16-4-15-27-30/h4-17,29H,3,18H2,1-2H3,(H,28,31) |
| InChIKey | MAZSXHHZYFKTNQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |