C19H19N3O3 — CID 111116122
N-[4-(2-hydroxyethoxy)phenyl]-4-(pyrazol-1-ylmethyl)benzamide (PubChem CID 111116122) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is N-[4-(2-hydroxyethoxy)phenyl]-4-(pyrazol-1-ylmethyl)benzamide.
| Compound Name | N-[4-(2-hydroxyethoxy)phenyl]-4-(pyrazol-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 111116122 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | N-[4-(2-hydroxyethoxy)phenyl]-4-(pyrazol-1-ylmethyl)benzamide |
| SMILES | O=C(Nc1ccc(OCCO)cc1)c1ccc(Cn2cccn2)cc1 |
| InChI | InChI=1S/C19H19N3O3/c23-12-13-25-18-8-6-17(7-9-18)21-19(24)16-4-2-15(3-5-16)14-22-11-1-10-20-22/h1-11,23H,12-14H2,(H,21,24) |
| InChIKey | SFMIYXZOPMEEBN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |