C20H16N4O2 — CID 78890208
N-[4-(1,3-oxazol-5-yl)phenyl]-4-(pyrazol-1-ylmethyl)benzamide (PubChem CID 78890208) has the molecular formula C20H16N4O2 and a molecular weight of 344.37 g/mol. Its IUPAC name is N-[4-(1,3-oxazol-5-yl)phenyl]-4-(pyrazol-1-ylmethyl)benzamide.
| Compound Name | N-[4-(1,3-oxazol-5-yl)phenyl]-4-(pyrazol-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 78890208 |
| Molecular Formula | C20H16N4O2 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N-[4-(1,3-oxazol-5-yl)phenyl]-4-(pyrazol-1-ylmethyl)benzamide |
| SMILES | O=C(Nc1ccc(-c2cnco2)cc1)c1ccc(Cn2cccn2)cc1 |
| InChI | InChI=1S/C20H16N4O2/c25-20(17-4-2-15(3-5-17)13-24-11-1-10-22-24)23-18-8-6-16(7-9-18)19-12-21-14-26-19/h1-12,14H,13H2,(H,23,25) |
| InChIKey | LHJUJSTZRFXLTL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |