C16H11IN2O2 — CID 60810765
3-iodo-N-[4-(1,3-oxazol-5-yl)phenyl]benzamide (PubChem CID 60810765) has the molecular formula C16H11IN2O2 and a molecular weight of 390.18 g/mol. Its IUPAC name is 3-iodo-N-[4-(1,3-oxazol-5-yl)phenyl]benzamide.
| Compound Name | 3-iodo-N-[4-(1,3-oxazol-5-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 60810765 |
| Molecular Formula | C16H11IN2O2 |
| Molecular Weight | 390.18 g/mol |
| Exact Mass | 389.99 |
| IUPAC Name | 3-iodo-N-[4-(1,3-oxazol-5-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-c2cnco2)cc1)c1cccc(I)c1 |
| InChI | InChI=1S/C16H11IN2O2/c17-13-3-1-2-12(8-13)16(20)19-14-6-4-11(5-7-14)15-9-18-10-21-15/h1-10H,(H,19,20) |
| InChIKey | AUWMHRRZFQNQBW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.18 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|