C14H9BrN2O2S — CID 61216626
3-bromo-N-[4-(1,3-oxazol-5-yl)phenyl]thiophene-2-carboxamide (PubChem CID 61216626) has the molecular formula C14H9BrN2O2S and a molecular weight of 349.21 g/mol. Its IUPAC name is 3-bromo-N-[4-(1,3-oxazol-5-yl)phenyl]thiophene-2-carboxamide.
| Compound Name | 3-bromo-N-[4-(1,3-oxazol-5-yl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 61216626 |
| Molecular Formula | C14H9BrN2O2S |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 347.96 |
| IUPAC Name | 3-bromo-N-[4-(1,3-oxazol-5-yl)phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(-c2cnco2)cc1)c1sccc1Br |
| InChI | InChI=1S/C14H9BrN2O2S/c15-11-5-6-20-13(11)14(18)17-10-3-1-9(2-4-10)12-7-16-8-19-12/h1-8H,(H,17,18) |
| InChIKey | XUQDAQFATMRREB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |