C17H14N2O3S — CID 22058498
(E)-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 22058498) has the molecular formula C17H14N2O3S and a molecular weight of 326.38 g/mol. Its IUPAC name is (E)-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 22058498 |
| Molecular Formula | C17H14N2O3S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | (E)-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | COc1cc(NC(=O)/C=C/c2cccs2)ccc1-c1cnco1 |
| InChI | InChI=1S/C17H14N2O3S/c1-21-15-9-12(4-6-14(15)16-10-18-11-22-16)19-17(20)7-5-13-3-2-8-23-13/h2-11H,1H3,(H,19,20)/b7-5+ |
| InChIKey | XTODCJWTFXNKQI-FNORWQNLSA-N |
| XLogP | 4.06 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|