C15H10ClN3O2 — CID 62233090
6-chloro-N-[4-(1,3-oxazol-5-yl)phenyl]pyridine-2-carboxamide (PubChem CID 62233090) has the molecular formula C15H10ClN3O2 and a molecular weight of 299.72 g/mol. Its IUPAC name is 6-chloro-N-[4-(1,3-oxazol-5-yl)phenyl]pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-[4-(1,3-oxazol-5-yl)phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62233090 |
| Molecular Formula | C15H10ClN3O2 |
| Molecular Weight | 299.72 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 6-chloro-N-[4-(1,3-oxazol-5-yl)phenyl]pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc(-c2cnco2)cc1)c1cccc(Cl)n1 |
| InChI | InChI=1S/C15H10ClN3O2/c16-14-3-1-2-12(19-14)15(20)18-11-6-4-10(5-7-11)13-8-17-9-21-13/h1-9H,(H,18,20) |
| InChIKey | GRNQSWZJSXZUOC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.72 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|