C13H13ClN2O2 — CID 63307748
4-chloro-N-[4-(1,3-oxazol-5-yl)phenyl]butanamide (PubChem CID 63307748) has the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. Its IUPAC name is 4-chloro-N-[4-(1,3-oxazol-5-yl)phenyl]butanamide.
| Compound Name | 4-chloro-N-[4-(1,3-oxazol-5-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 63307748 |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 4-chloro-N-[4-(1,3-oxazol-5-yl)phenyl]butanamide |
| SMILES | O=C(CCCCl)Nc1ccc(-c2cnco2)cc1 |
| InChI | InChI=1S/C13H13ClN2O2/c14-7-1-2-13(17)16-11-5-3-10(4-6-11)12-8-15-9-18-12/h3-6,8-9H,1-2,7H2,(H,16,17) |
| InChIKey | MYTLRURNSOEMAD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|