C14H15N3O2 — CID 79286058
N-[4-(1,3-oxazol-5-yl)phenyl]-2-(prop-2-enylamino)acetamide (PubChem CID 79286058) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is N-[4-(1,3-oxazol-5-yl)phenyl]-2-(prop-2-enylamino)acetamide.
| Compound Name | N-[4-(1,3-oxazol-5-yl)phenyl]-2-(prop-2-enylamino)acetamide |
|---|---|
| PubChem CID | 79286058 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-[4-(1,3-oxazol-5-yl)phenyl]-2-(prop-2-enylamino)acetamide |
| SMILES | C=CCNCC(=O)Nc1ccc(-c2cnco2)cc1 |
| InChI | InChI=1S/C14H15N3O2/c1-2-7-15-9-14(18)17-12-5-3-11(4-6-12)13-8-16-10-19-13/h2-6,8,10,15H,1,7,9H2,(H,17,18) |
| InChIKey | KRBPTVUKRTTXDJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|