C17H23N3O4S — CID 20629196
N-[4-(1,3-oxazol-5-yl)phenyl]-5-(propan-2-ylsulfonylamino)pentanamide (PubChem CID 20629196) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is N-[4-(1,3-oxazol-5-yl)phenyl]-5-(propan-2-ylsulfonylamino)pentanamide.
| Compound Name | N-[4-(1,3-oxazol-5-yl)phenyl]-5-(propan-2-ylsulfonylamino)pentanamide |
|---|---|
| PubChem CID | 20629196 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-[4-(1,3-oxazol-5-yl)phenyl]-5-(propan-2-ylsulfonylamino)pentanamide |
| SMILES | CC(C)S(=O)(=O)NCCCCC(=O)Nc1ccc(-c2cnco2)cc1 |
| InChI | InChI=1S/C17H23N3O4S/c1-13(2)25(22,23)19-10-4-3-5-17(21)20-15-8-6-14(7-9-15)16-11-18-12-24-16/h6-9,11-13,19H,3-5,10H2,1-2H3,(H,20,21) |
| InChIKey | VPRGUSJYUZLNAF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|