C18H25N3O4S — CID 20630720
5-(tert-butylsulfonylamino)-N-[4-(1,3-oxazol-5-yl)phenyl]pentanamide (PubChem CID 20630720) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is 5-(tert-butylsulfonylamino)-N-[4-(1,3-oxazol-5-yl)phenyl]pentanamide.
| Compound Name | 5-(tert-butylsulfonylamino)-N-[4-(1,3-oxazol-5-yl)phenyl]pentanamide |
|---|---|
| PubChem CID | 20630720 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 5-(tert-butylsulfonylamino)-N-[4-(1,3-oxazol-5-yl)phenyl]pentanamide |
| SMILES | CC(C)(C)S(=O)(=O)NCCCCC(=O)Nc1ccc(-c2cnco2)cc1 |
| InChI | InChI=1S/C18H25N3O4S/c1-18(2,3)26(23,24)20-11-5-4-6-17(22)21-15-9-7-14(8-10-15)16-12-19-13-25-16/h7-10,12-13,20H,4-6,11H2,1-3H3,(H,21,22) |
| InChIKey | FDZDJCXYKJXUAU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|