C20H33N3O4S — CID 58958265
5-(tert-butylsulfonylamino)-N-[4-(2,2-dimethylpropanoylamino)phenyl]pentanamide (PubChem CID 58958265) has the molecular formula C20H33N3O4S and a molecular weight of 411.57 g/mol. Its IUPAC name is 5-(tert-butylsulfonylamino)-N-[4-(2,2-dimethylpropanoylamino)phenyl]pentanamide.
| Compound Name | 5-(tert-butylsulfonylamino)-N-[4-(2,2-dimethylpropanoylamino)phenyl]pentanamide |
|---|---|
| PubChem CID | 58958265 |
| Molecular Formula | C20H33N3O4S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 5-(tert-butylsulfonylamino)-N-[4-(2,2-dimethylpropanoylamino)phenyl]pentanamide |
| SMILES | CC(C)(C)C(=O)Nc1ccc(NC(=O)CCCCNS(=O)(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H33N3O4S/c1-19(2,3)18(25)23-16-12-10-15(11-13-16)22-17(24)9-7-8-14-21-28(26,27)20(4,5)6/h10-13,21H,7-9,14H2,1-6H3,(H,22,24)(H,23,25) |
| InChIKey | VRVSBNDIMLUZLL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|