C25H42N4O3S — CID 20630295
5-(tert-butylsulfonylamino)-N-[4-(4-cyclohexylpiperazin-1-yl)phenyl]pentanamide (PubChem CID 20630295) has the molecular formula C25H42N4O3S and a molecular weight of 478.70 g/mol. Its IUPAC name is 5-(tert-butylsulfonylamino)-N-[4-(4-cyclohexylpiperazin-1-yl)phenyl]pentanamide.
| Compound Name | 5-(tert-butylsulfonylamino)-N-[4-(4-cyclohexylpiperazin-1-yl)phenyl]pentanamide |
|---|---|
| PubChem CID | 20630295 |
| Molecular Formula | C25H42N4O3S |
| Molecular Weight | 478.70 g/mol |
| Exact Mass | 478.30 |
| IUPAC Name | 5-(tert-butylsulfonylamino)-N-[4-(4-cyclohexylpiperazin-1-yl)phenyl]pentanamide |
| SMILES | CC(C)(C)S(=O)(=O)NCCCCC(=O)Nc1ccc(N2CCN(C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C25H42N4O3S/c1-25(2,3)33(31,32)26-16-8-7-11-24(30)27-21-12-14-23(15-13-21)29-19-17-28(18-20-29)22-9-5-4-6-10-22/h12-15,22,26H,4-11,16-20H2,1-3H3,(H,27,30) |
| InChIKey | MFEWALNZAMWNER-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.70 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|