C22H29N3OS — CID 112502781
N-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-2-thiophen-2-ylacetamide (PubChem CID 112502781) has the molecular formula C22H29N3OS and a molecular weight of 383.56 g/mol. Its IUPAC name is N-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 112502781 |
| Molecular Formula | C22H29N3OS |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)Nc1ccc(N2CCN(C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C22H29N3OS/c26-22(17-21-7-4-16-27-21)23-18-8-10-20(11-9-18)25-14-12-24(13-15-25)19-5-2-1-3-6-19/h4,7-11,16,19H,1-3,5-6,12-15,17H2,(H,23,26) |
| InChIKey | OIYCBDPTVFTOJN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|