C23H25N3OS — CID 112984453
N-[4-[4-(3-methylphenyl)piperazin-1-yl]phenyl]-2-thiophen-2-ylacetamide (PubChem CID 112984453) has the molecular formula C23H25N3OS and a molecular weight of 391.54 g/mol. Its IUPAC name is N-[4-[4-(3-methylphenyl)piperazin-1-yl]phenyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[4-[4-(3-methylphenyl)piperazin-1-yl]phenyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 112984453 |
| Molecular Formula | C23H25N3OS |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | N-[4-[4-(3-methylphenyl)piperazin-1-yl]phenyl]-2-thiophen-2-ylacetamide |
| SMILES | Cc1cccc(N2CCN(c3ccc(NC(=O)Cc4cccs4)cc3)CC2)c1 |
| InChI | InChI=1S/C23H25N3OS/c1-18-4-2-5-21(16-18)26-13-11-25(12-14-26)20-9-7-19(8-10-20)24-23(27)17-22-6-3-15-28-22/h2-10,15-16H,11-14,17H2,1H3,(H,24,27) |
| InChIKey | MPCNOQNRVRUKSG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|