C20H36N4O2S — CID 59230957
2-methyl-N-[5-[4-(4-methylpiperazin-1-yl)anilino]pentyl]propane-2-sulfonamide (PubChem CID 59230957) has the molecular formula C20H36N4O2S and a molecular weight of 396.60 g/mol. Its IUPAC name is 2-methyl-N-[5-[4-(4-methylpiperazin-1-yl)anilino]pentyl]propane-2-sulfonamide.
| Compound Name | 2-methyl-N-[5-[4-(4-methylpiperazin-1-yl)anilino]pentyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 59230957 |
| Molecular Formula | C20H36N4O2S |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 2-methyl-N-[5-[4-(4-methylpiperazin-1-yl)anilino]pentyl]propane-2-sulfonamide |
| SMILES | CN1CCN(c2ccc(NCCCCCNS(=O)(=O)C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C20H36N4O2S/c1-20(2,3)27(25,26)22-13-7-5-6-12-21-18-8-10-19(11-9-18)24-16-14-23(4)15-17-24/h8-11,21-22H,5-7,12-17H2,1-4H3 |
| InChIKey | YPHXANDWONPAKD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|