C22H38N2O2S — CID 59545904
1-[4-(7-tert-butylsulfonylheptyl)phenyl]-4-methylpiperazine (PubChem CID 59545904) has the molecular formula C22H38N2O2S and a molecular weight of 394.63 g/mol. Its IUPAC name is 1-[4-(7-tert-butylsulfonylheptyl)phenyl]-4-methylpiperazine.
| Compound Name | 1-[4-(7-tert-butylsulfonylheptyl)phenyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 59545904 |
| Molecular Formula | C22H38N2O2S |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 1-[4-(7-tert-butylsulfonylheptyl)phenyl]-4-methylpiperazine |
| SMILES | CN1CCN(c2ccc(CCCCCCCS(=O)(=O)C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C22H38N2O2S/c1-22(2,3)27(25,26)19-9-7-5-6-8-10-20-11-13-21(14-12-20)24-17-15-23(4)16-18-24/h11-14H,5-10,15-19H2,1-4H3 |
| InChIKey | HDJLGEHOCQBKSL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|