C21H36N2O2S — CID 59545521
1-methyl-4-[4-(7-propan-2-ylsulfonylheptyl)phenyl]piperazine (PubChem CID 59545521) has the molecular formula C21H36N2O2S and a molecular weight of 380.60 g/mol. Its IUPAC name is 1-methyl-4-[4-(7-propan-2-ylsulfonylheptyl)phenyl]piperazine.
| Compound Name | 1-methyl-4-[4-(7-propan-2-ylsulfonylheptyl)phenyl]piperazine |
|---|---|
| PubChem CID | 59545521 |
| Molecular Formula | C21H36N2O2S |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | 1-methyl-4-[4-(7-propan-2-ylsulfonylheptyl)phenyl]piperazine |
| SMILES | CC(C)S(=O)(=O)CCCCCCCc1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C21H36N2O2S/c1-19(2)26(24,25)18-8-6-4-5-7-9-20-10-12-21(13-11-20)23-16-14-22(3)15-17-23/h10-13,19H,4-9,14-18H2,1-3H3 |
| InChIKey | MLIGCBQTEOOUKV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|