C28H40ClNO3S — CID 59549844
4-(4-chlorophenyl)-1-[4-(5-methyl-7-propan-2-ylsulfonylheptyl)phenyl]piperidin-4-ol (PubChem CID 59549844) has the molecular formula C28H40ClNO3S and a molecular weight of 506.15 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-[4-(5-methyl-7-propan-2-ylsulfonylheptyl)phenyl]piperidin-4-ol.
| Compound Name | 4-(4-chlorophenyl)-1-[4-(5-methyl-7-propan-2-ylsulfonylheptyl)phenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 59549844 |
| Molecular Formula | C28H40ClNO3S |
| Molecular Weight | 506.15 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | 4-(4-chlorophenyl)-1-[4-(5-methyl-7-propan-2-ylsulfonylheptyl)phenyl]piperidin-4-ol |
| SMILES | CC(CCCCc1ccc(N2CCC(O)(c3ccc(Cl)cc3)CC2)cc1)CCS(=O)(=O)C(C)C |
| InChI | InChI=1S/C28H40ClNO3S/c1-22(2)34(32,33)21-16-23(3)6-4-5-7-24-8-14-27(15-9-24)30-19-17-28(31,18-20-30)25-10-12-26(29)13-11-25/h8-15,22-23,31H,4-7,16-21H2,1-3H3 |
| InChIKey | UNVYUJGIQNMNQV-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.15 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|