C27H30ClNO — CID 59545807
4-(4-chlorophenyl)-1-[4-[2-(3,4-dimethylphenyl)ethyl]phenyl]piperidin-4-ol (PubChem CID 59545807) has the molecular formula C27H30ClNO and a molecular weight of 420.00 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-[4-[2-(3,4-dimethylphenyl)ethyl]phenyl]piperidin-4-ol.
| Compound Name | 4-(4-chlorophenyl)-1-[4-[2-(3,4-dimethylphenyl)ethyl]phenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 59545807 |
| Molecular Formula | C27H30ClNO |
| Molecular Weight | 420.00 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 4-(4-chlorophenyl)-1-[4-[2-(3,4-dimethylphenyl)ethyl]phenyl]piperidin-4-ol |
| SMILES | Cc1ccc(CCc2ccc(N3CCC(O)(c4ccc(Cl)cc4)CC3)cc2)cc1C |
| InChI | InChI=1S/C27H30ClNO/c1-20-3-4-23(19-21(20)2)6-5-22-7-13-26(14-8-22)29-17-15-27(30,16-18-29)24-9-11-25(28)12-10-24/h3-4,7-14,19,30H,5-6,15-18H2,1-2H3 |
| InChIKey | GMZHMTVKYZHJAP-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.00 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|