C30H42ClNOS — CID 59545212
1-[4-[2-[4-(tert-butylsulfanylmethyl)cyclohexyl]ethyl]phenyl]-4-(4-chlorophenyl)piperidin-4-ol (PubChem CID 59545212) has the molecular formula C30H42ClNOS and a molecular weight of 500.19 g/mol. Its IUPAC name is 1-[4-[2-[4-(tert-butylsulfanylmethyl)cyclohexyl]ethyl]phenyl]-4-(4-chlorophenyl)piperidin-4-ol.
| Compound Name | 1-[4-[2-[4-(tert-butylsulfanylmethyl)cyclohexyl]ethyl]phenyl]-4-(4-chlorophenyl)piperidin-4-ol |
|---|---|
| PubChem CID | 59545212 |
| Molecular Formula | C30H42ClNOS |
| Molecular Weight | 500.19 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | 1-[4-[2-[4-(tert-butylsulfanylmethyl)cyclohexyl]ethyl]phenyl]-4-(4-chlorophenyl)piperidin-4-ol |
| SMILES | CC(C)(C)SCC1CCC(CCc2ccc(N3CCC(O)(c4ccc(Cl)cc4)CC3)cc2)CC1 |
| InChI | InChI=1S/C30H42ClNOS/c1-29(2,3)34-22-25-8-6-23(7-9-25)4-5-24-10-16-28(17-11-24)32-20-18-30(33,19-21-32)26-12-14-27(31)15-13-26/h10-17,23,25,33H,4-9,18-22H2,1-3H3 |
| InChIKey | JMXUXBHFAJFYIS-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.19 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|