C24H32ClNO — CID 59545535
4-(4-chlorophenyl)-1-(4-heptylphenyl)piperidin-4-ol (PubChem CID 59545535) has the molecular formula C24H32ClNO and a molecular weight of 385.98 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-(4-heptylphenyl)piperidin-4-ol.
| Compound Name | 4-(4-chlorophenyl)-1-(4-heptylphenyl)piperidin-4-ol |
|---|---|
| PubChem CID | 59545535 |
| Molecular Formula | C24H32ClNO |
| Molecular Weight | 385.98 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 4-(4-chlorophenyl)-1-(4-heptylphenyl)piperidin-4-ol |
| SMILES | CCCCCCCc1ccc(N2CCC(O)(c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H32ClNO/c1-2-3-4-5-6-7-20-8-14-23(15-9-20)26-18-16-24(27,17-19-26)21-10-12-22(25)13-11-21/h8-15,27H,2-7,16-19H2,1H3 |
| InChIKey | QYDJUWADOZVNON-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.98 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|