C27H36ClNO4S — CID 58145755
1-[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]phenyl]-7-propan-2-ylsulfonylheptan-2-one (PubChem CID 58145755) has the molecular formula C27H36ClNO4S and a molecular weight of 506.11 g/mol. Its IUPAC name is 1-[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]phenyl]-7-propan-2-ylsulfonylheptan-2-one.
| Compound Name | 1-[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]phenyl]-7-propan-2-ylsulfonylheptan-2-one |
|---|---|
| PubChem CID | 58145755 |
| Molecular Formula | C27H36ClNO4S |
| Molecular Weight | 506.11 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | 1-[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]phenyl]-7-propan-2-ylsulfonylheptan-2-one |
| SMILES | CC(C)S(=O)(=O)CCCCCC(=O)Cc1ccc(N2CCC(O)(c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H36ClNO4S/c1-21(2)34(32,33)19-5-3-4-6-26(30)20-22-7-13-25(14-8-22)29-17-15-27(31,16-18-29)23-9-11-24(28)12-10-23/h7-14,21,31H,3-6,15-20H2,1-2H3 |
| InChIKey | OUSCWCOHQKZJKV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.11 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|