C27H33NO5S — CID 58145441
5-(2-oxo-7-propan-2-ylsulfonylheptyl)-2-(4-propan-2-ylphenyl)isoindole-1,3-dione (PubChem CID 58145441) has the molecular formula C27H33NO5S and a molecular weight of 483.63 g/mol. Its IUPAC name is 5-(2-oxo-7-propan-2-ylsulfonylheptyl)-2-(4-propan-2-ylphenyl)isoindole-1,3-dione.
| Compound Name | 5-(2-oxo-7-propan-2-ylsulfonylheptyl)-2-(4-propan-2-ylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 58145441 |
| Molecular Formula | C27H33NO5S |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | 5-(2-oxo-7-propan-2-ylsulfonylheptyl)-2-(4-propan-2-ylphenyl)isoindole-1,3-dione |
| SMILES | CC(C)c1ccc(N2C(=O)c3ccc(CC(=O)CCCCCS(=O)(=O)C(C)C)cc3C2=O)cc1 |
| InChI | InChI=1S/C27H33NO5S/c1-18(2)21-10-12-22(13-11-21)28-26(30)24-14-9-20(17-25(24)27(28)31)16-23(29)8-6-5-7-15-34(32,33)19(3)4/h9-14,17-19H,5-8,15-16H2,1-4H3 |
| InChIKey | FTVPUAQMKHBCFV-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|