C26H33N3O5S — CID 20629318
N-[2-(4-butan-2-ylphenyl)-1,3-dioxoisoindol-5-yl]-5-(propan-2-ylsulfonylamino)pentanamide (PubChem CID 20629318) has the molecular formula C26H33N3O5S and a molecular weight of 499.63 g/mol. Its IUPAC name is N-[2-(4-butan-2-ylphenyl)-1,3-dioxoisoindol-5-yl]-5-(propan-2-ylsulfonylamino)pentanamide.
| Compound Name | N-[2-(4-butan-2-ylphenyl)-1,3-dioxoisoindol-5-yl]-5-(propan-2-ylsulfonylamino)pentanamide |
|---|---|
| PubChem CID | 20629318 |
| Molecular Formula | C26H33N3O5S |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | N-[2-(4-butan-2-ylphenyl)-1,3-dioxoisoindol-5-yl]-5-(propan-2-ylsulfonylamino)pentanamide |
| SMILES | CCC(C)c1ccc(N2C(=O)c3ccc(NC(=O)CCCCNS(=O)(=O)C(C)C)cc3C2=O)cc1 |
| InChI | InChI=1S/C26H33N3O5S/c1-5-18(4)19-9-12-21(13-10-19)29-25(31)22-14-11-20(16-23(22)26(29)32)28-24(30)8-6-7-15-27-35(33,34)17(2)3/h9-14,16-18,27H,5-8,15H2,1-4H3,(H,28,30) |
| InChIKey | OSPNKCMGIHTLEY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|