C23H29N3O2 — CID 59230472
5-(5-aminopentylamino)-2-(4-butan-2-ylphenyl)isoindole-1,3-dione (PubChem CID 59230472) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 5-(5-aminopentylamino)-2-(4-butan-2-ylphenyl)isoindole-1,3-dione.
| Compound Name | 5-(5-aminopentylamino)-2-(4-butan-2-ylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 59230472 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 5-(5-aminopentylamino)-2-(4-butan-2-ylphenyl)isoindole-1,3-dione |
| SMILES | CCC(C)c1ccc(N2C(=O)c3ccc(NCCCCCN)cc3C2=O)cc1 |
| InChI | InChI=1S/C23H29N3O2/c1-3-16(2)17-7-10-19(11-8-17)26-22(27)20-12-9-18(15-21(20)23(26)28)25-14-6-4-5-13-24/h7-12,15-16,25H,3-6,13-14,24H2,1-2H3 |
| InChIKey | RWKGCHGTOILAEM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|