C22H29N3O4 — CID 161470371
5-(8-aminooctylamino)-2-(2,4-dioxocyclohexyl)isoindole-1,3-dione (PubChem CID 161470371) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is 5-(8-aminooctylamino)-2-(2,4-dioxocyclohexyl)isoindole-1,3-dione.
| Compound Name | 5-(8-aminooctylamino)-2-(2,4-dioxocyclohexyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 161470371 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 5-(8-aminooctylamino)-2-(2,4-dioxocyclohexyl)isoindole-1,3-dione |
| SMILES | NCCCCCCCCNc1ccc2c(c1)C(=O)N(C1CCC(=O)CC1=O)C2=O |
| InChI | InChI=1S/C22H29N3O4/c23-11-5-3-1-2-4-6-12-24-15-7-9-17-18(13-15)22(29)25(21(17)28)19-10-8-16(26)14-20(19)27/h7,9,13,19,24H,1-6,8,10-12,14,23H2 |
| InChIKey | AVIPBNPGQYBGCX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|