C23H29N3O6 — CID 163374317
methyl 9-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]nonanoate (PubChem CID 163374317) has the molecular formula C23H29N3O6 and a molecular weight of 443.50 g/mol. Its IUPAC name is methyl 9-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]nonanoate.
| Compound Name | methyl 9-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]nonanoate |
|---|---|
| PubChem CID | 163374317 |
| Molecular Formula | C23H29N3O6 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | methyl 9-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]nonanoate |
| SMILES | COC(=O)CCCCCCCCNc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C23H29N3O6/c1-32-20(28)8-6-4-2-3-5-7-13-24-15-9-10-16-17(14-15)23(31)26(22(16)30)18-11-12-19(27)25-21(18)29/h9-10,14,18,24H,2-8,11-13H2,1H3,(H,25,27,29) |
| InChIKey | NRJMCVMHAAVREL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|