C26H29N3O7S — CID 162512411
6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]hexyl 4-methylbenzenesulfonate (PubChem CID 162512411) has the molecular formula C26H29N3O7S and a molecular weight of 527.60 g/mol. Its IUPAC name is 6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]hexyl 4-methylbenzenesulfonate.
| Compound Name | 6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]hexyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 162512411 |
| Molecular Formula | C26H29N3O7S |
| Molecular Weight | 527.60 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | 6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]hexyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCCCNc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C26H29N3O7S/c1-17-6-9-19(10-7-17)37(34,35)36-15-5-3-2-4-14-27-18-8-11-20-21(16-18)26(33)29(25(20)32)22-12-13-23(30)28-24(22)31/h6-11,16,22,27H,2-5,12-15H2,1H3,(H,28,30,31) |
| InChIKey | BEPGXPRJVFPEMV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.60 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|