C19H22IN3O5S — CID 169150145
6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]hexoxy thiohypoiodite (PubChem CID 169150145) has the molecular formula C19H22IN3O5S and a molecular weight of 531.37 g/mol. Its IUPAC name is 6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]hexoxy thiohypoiodite.
| Compound Name | 6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]hexoxy thiohypoiodite |
|---|---|
| PubChem CID | 169150145 |
| Molecular Formula | C19H22IN3O5S |
| Molecular Weight | 531.37 g/mol |
| Exact Mass | 531.03 |
| IUPAC Name | 6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]hexoxy thiohypoiodite |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NCCCCCCOSI)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H22IN3O5S/c20-29-28-10-4-2-1-3-9-21-12-5-6-13-14(11-12)19(27)23(18(13)26)15-7-8-16(24)22-17(15)25/h5-6,11,15,21H,1-4,7-10H2,(H,22,24,25) |
| InChIKey | QLTVIDUFLDWEHR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|