C21H25N3O9 — CID 171566931
2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]ethoxy]ethoxy]acetic acid (PubChem CID 171566931) has the molecular formula C21H25N3O9 and a molecular weight of 463.44 g/mol. Its IUPAC name is 2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 171566931 |
| Molecular Formula | C21H25N3O9 |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]ethoxy]ethoxy]acetic acid |
| SMILES | O=C(O)COCCOCCOCCNc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C21H25N3O9/c25-17-4-3-16(19(28)23-17)24-20(29)14-2-1-13(11-15(14)21(24)30)22-5-6-31-7-8-32-9-10-33-12-18(26)27/h1-2,11,16,22H,3-10,12H2,(H,26,27)(H,23,25,28) |
| InChIKey | CJWHVKKRZXHJQC-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 160.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|