C30H43N5O9 — CID 154659236
tert-butyl 4-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]ethoxy]ethoxy]ethyl]piperazine-1-carboxylate (PubChem CID 154659236) has the molecular formula C30H43N5O9 and a molecular weight of 617.70 g/mol. Its IUPAC name is tert-butyl 4-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]ethoxy]ethoxy]ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]ethoxy]ethoxy]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 154659236 |
| Molecular Formula | C30H43N5O9 |
| Molecular Weight | 617.70 g/mol |
| Exact Mass | 617.31 |
| IUPAC Name | tert-butyl 4-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]ethoxy]ethoxy]ethyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCOCCOCCOCCNc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C30H43N5O9/c1-30(2,3)44-29(40)34-11-9-33(10-12-34)13-15-42-17-19-43-18-16-41-14-8-31-21-4-5-22-23(20-21)28(39)35(27(22)38)24-6-7-25(36)32-26(24)37/h4-5,20,24,31H,6-19H2,1-3H3,(H,32,36,37) |
| InChIKey | TWQHDODIESUXKS-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 156.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.70 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|