C26H30F3N3O11 — CID 166681221
(2,2,2-trifluoroacetyl) 3-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 166681221) has the molecular formula C26H30F3N3O11 and a molecular weight of 617.53 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 166681221 |
| Molecular Formula | C26H30F3N3O11 |
| Molecular Weight | 617.53 g/mol |
| Exact Mass | 617.18 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NCCOCCOCCOCCOCCC(=O)OC(=O)C(F)(F)F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H30F3N3O11/c27-26(28,29)25(38)43-21(34)5-7-39-9-11-41-13-14-42-12-10-40-8-6-30-16-1-2-17-18(15-16)24(37)32(23(17)36)19-3-4-20(33)31-22(19)35/h1-2,15,19,30H,3-14H2,(H,31,33,35) |
| InChIKey | SAFIYTGWUWHNJF-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 175.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.53 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|