C30H42N4O12 — CID 154659290
tert-butyl N-[2-[2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]-2-oxoethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 154659290) has the molecular formula C30H42N4O12 and a molecular weight of 650.68 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]-2-oxoethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]-2-oxoethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 154659290 |
| Molecular Formula | C30H42N4O12 |
| Molecular Weight | 650.68 g/mol |
| Exact Mass | 650.28 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]-2-oxoethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCC(=O)Nc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C30H42N4O12/c1-30(2,3)46-29(40)31-8-9-41-10-11-42-12-13-43-14-15-44-16-17-45-19-25(36)32-20-4-5-21-22(18-20)28(39)34(27(21)38)23-6-7-24(35)33-26(23)37/h4-5,18,23H,6-17,19H2,1-3H3,(H,31,40)(H,32,36)(H,33,35,37) |
| InChIKey | HQYHNUIDUUKBET-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 197.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.68 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|