C21H26N4O6 — CID 142367921
tert-butyl N-[(2R)-2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]propyl]carbamate (PubChem CID 142367921) has the molecular formula C21H26N4O6 and a molecular weight of 430.46 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 142367921 |
| Molecular Formula | C21H26N4O6 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | tert-butyl N-[(2R)-2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]propyl]carbamate |
| SMILES | C[C@H](CNC(=O)OC(C)(C)C)Nc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C21H26N4O6/c1-11(10-22-20(30)31-21(2,3)4)23-12-5-6-13-14(9-12)19(29)25(18(13)28)15-7-8-16(26)24-17(15)27/h5-6,9,11,15,23H,7-8,10H2,1-4H3,(H,22,30)(H,24,26,27)/t11-,15?/m1/s1 |
| InChIKey | KTLZRXUPBPIEDE-ZRKZCGFPSA-N |
| XLogP | 1.41 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|