C28H40N5O10- — CID 163620929
[3-[5-[2-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxyamino]-1,3-dioxoisoindol-2-yl]-6-oxopiperidin-2-ylidene]azanide (PubChem CID 163620929) has the molecular formula C28H40N5O10- and a molecular weight of 606.65 g/mol. Its IUPAC name is [3-[5-[2-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxyamino]-1,3-dioxoisoindol-2-yl]-6-oxopiperidin-2-ylidene]azanide.
| Compound Name | [3-[5-[2-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxyamino]-1,3-dioxoisoindol-2-yl]-6-oxopiperidin-2-ylidene]azanide |
|---|---|
| PubChem CID | 163620929 |
| Molecular Formula | C28H40N5O10- |
| Molecular Weight | 606.65 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | [3-[5-[2-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxyamino]-1,3-dioxoisoindol-2-yl]-6-oxopiperidin-2-ylidene]azanide |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCONc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=[N-])C2=O |
| InChI | InChI=1S/C28H40N5O10/c1-28(2,3)43-27(37)30-8-9-38-10-11-39-12-13-40-14-15-41-16-17-42-32-19-4-5-20-21(18-19)26(36)33(25(20)35)22-6-7-23(34)31-24(22)29/h4-5,18,22H,6-17H2,1-3H3,(H3-,29,30,31,32,34,35,37)/q-1 |
| InChIKey | HOASOUGYEIGQBX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 185.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.65 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|